C38H41NO4 — CID 142994795
N-(2,2-dimethyl-4-oxo-1,3-benzodioxin-6-yl)-4-heptyl-N-[[4-(4-methylphenyl)phenyl]methyl]benzamide (PubChem CID 142994795) has the molecular formula C38H41NO4 and a molecular weight of 575.75 g/mol. Its IUPAC name is N-(2,2-dimethyl-4-oxo-1,3-benzodioxin-6-yl)-4-heptyl-N-[[4-(4-methylphenyl)phenyl]methyl]benzamide.
| Compound Name | N-(2,2-dimethyl-4-oxo-1,3-benzodioxin-6-yl)-4-heptyl-N-[[4-(4-methylphenyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 142994795 |
| Molecular Formula | C38H41NO4 |
| Molecular Weight | 575.75 g/mol |
| Exact Mass | 575.30 |
| IUPAC Name | N-(2,2-dimethyl-4-oxo-1,3-benzodioxin-6-yl)-4-heptyl-N-[[4-(4-methylphenyl)phenyl]methyl]benzamide |
| SMILES | CCCCCCCc1ccc(C(=O)N(Cc2ccc(-c3ccc(C)cc3)cc2)c2ccc3c(c2)C(=O)OC(C)(C)O3)cc1 |
| InChI | InChI=1S/C38H41NO4/c1-5-6-7-8-9-10-28-13-21-32(22-14-28)36(40)39(33-23-24-35-34(25-33)37(41)43-38(3,4)42-35)26-29-15-19-31(20-16-29)30-17-11-27(2)12-18-30/h11-25H,5-10,26H2,1-4H3 |
| InChIKey | BBCBGPLCANTLCF-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.75 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|