C34H39NO4 — CID 89152912
(E)-N-(2,2-dimethyl-4-oxo-1,3-benzodioxin-6-yl)-N-[(4-octylphenyl)methyl]-3-phenylprop-2-enamide (PubChem CID 89152912) has the molecular formula C34H39NO4 and a molecular weight of 525.69 g/mol. Its IUPAC name is (E)-N-(2,2-dimethyl-4-oxo-1,3-benzodioxin-6-yl)-N-[(4-octylphenyl)methyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-(2,2-dimethyl-4-oxo-1,3-benzodioxin-6-yl)-N-[(4-octylphenyl)methyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 89152912 |
| Molecular Formula | C34H39NO4 |
| Molecular Weight | 525.69 g/mol |
| Exact Mass | 525.29 |
| IUPAC Name | (E)-N-(2,2-dimethyl-4-oxo-1,3-benzodioxin-6-yl)-N-[(4-octylphenyl)methyl]-3-phenylprop-2-enamide |
| SMILES | CCCCCCCCc1ccc(CN(C(=O)/C=C/c2ccccc2)c2ccc3c(c2)C(=O)OC(C)(C)O3)cc1 |
| InChI | InChI=1S/C34H39NO4/c1-4-5-6-7-8-10-15-27-16-18-28(19-17-27)25-35(32(36)23-20-26-13-11-9-12-14-26)29-21-22-31-30(24-29)33(37)39-34(2,3)38-31/h9,11-14,16-24H,4-8,10,15,25H2,1-3H3/b23-20+ |
| InChIKey | OKNBHRIYCZWNRL-BSYVCWPDSA-N |
| XLogP | 8.12 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.69 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|