C36H43NO6 — CID 70924430
methyl 8-[[4-(4-butylphenyl)phenyl]methyl-(2,2-dimethyl-4-oxo-1,3-benzodioxin-6-yl)amino]-8-oxooctanoate (PubChem CID 70924430) has the molecular formula C36H43NO6 and a molecular weight of 585.74 g/mol. Its IUPAC name is methyl 8-[[4-(4-butylphenyl)phenyl]methyl-(2,2-dimethyl-4-oxo-1,3-benzodioxin-6-yl)amino]-8-oxooctanoate.
| Compound Name | methyl 8-[[4-(4-butylphenyl)phenyl]methyl-(2,2-dimethyl-4-oxo-1,3-benzodioxin-6-yl)amino]-8-oxooctanoate |
|---|---|
| PubChem CID | 70924430 |
| Molecular Formula | C36H43NO6 |
| Molecular Weight | 585.74 g/mol |
| Exact Mass | 585.31 |
| IUPAC Name | methyl 8-[[4-(4-butylphenyl)phenyl]methyl-(2,2-dimethyl-4-oxo-1,3-benzodioxin-6-yl)amino]-8-oxooctanoate |
| SMILES | CCCCc1ccc(-c2ccc(CN(C(=O)CCCCCCC(=O)OC)c3ccc4c(c3)C(=O)OC(C)(C)O4)cc2)cc1 |
| InChI | InChI=1S/C36H43NO6/c1-5-6-11-26-14-18-28(19-15-26)29-20-16-27(17-21-29)25-37(33(38)12-9-7-8-10-13-34(39)41-4)30-22-23-32-31(24-30)35(40)43-36(2,3)42-32/h14-24H,5-13,25H2,1-4H3 |
| InChIKey | LMNUBBDNOSOXNA-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.74 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|