C34H37NO6 — CID 11341912
5-[[4-[2-(4-butylphenyl)ethynyl]phenyl]methyl-(7-carboxyheptanoyl)amino]-2-hydroxybenzoic acid (PubChem CID 11341912) has the molecular formula C34H37NO6 and a molecular weight of 555.67 g/mol. Its IUPAC name is 5-[[4-[2-(4-butylphenyl)ethynyl]phenyl]methyl-(7-carboxyheptanoyl)amino]-2-hydroxybenzoic acid.
| Compound Name | 5-[[4-[2-(4-butylphenyl)ethynyl]phenyl]methyl-(7-carboxyheptanoyl)amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 11341912 |
| Molecular Formula | C34H37NO6 |
| Molecular Weight | 555.67 g/mol |
| Exact Mass | 555.26 |
| IUPAC Name | 5-[[4-[2-(4-butylphenyl)ethynyl]phenyl]methyl-(7-carboxyheptanoyl)amino]-2-hydroxybenzoic acid |
| SMILES | CCCCc1ccc(C#Cc2ccc(CN(C(=O)CCCCCCC(=O)O)c3ccc(O)c(C(=O)O)c3)cc2)cc1 |
| InChI | InChI=1S/C34H37NO6/c1-2-3-8-25-11-13-26(14-12-25)15-16-27-17-19-28(20-18-27)24-35(29-21-22-31(36)30(23-29)34(40)41)32(37)9-6-4-5-7-10-33(38)39/h11-14,17-23,36H,2-10,24H2,1H3,(H,38,39)(H,40,41) |
| InChIKey | OYBQZVDZBOOJDU-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.67 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|