C38H52N2O8 — CID 11607133
5-[hexyl-[[4-[2-(4-propylphenyl)ethynyl]phenyl]methyl]amino]-2-hydroxybenzoic acid;(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol (PubChem CID 11607133) has the molecular formula C38H52N2O8 and a molecular weight of 664.84 g/mol. Its IUPAC name is 5-[hexyl-[[4-[2-(4-propylphenyl)ethynyl]phenyl]methyl]amino]-2-hydroxybenzoic acid;(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol.
| Compound Name | 5-[hexyl-[[4-[2-(4-propylphenyl)ethynyl]phenyl]methyl]amino]-2-hydroxybenzoic acid;(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 11607133 |
| Molecular Formula | C38H52N2O8 |
| Molecular Weight | 664.84 g/mol |
| Exact Mass | 664.37 |
| IUPAC Name | 5-[hexyl-[[4-[2-(4-propylphenyl)ethynyl]phenyl]methyl]amino]-2-hydroxybenzoic acid;(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol |
| SMILES | CCCCCCN(Cc1ccc(C#Cc2ccc(CCC)cc2)cc1)c1ccc(O)c(C(=O)O)c1.CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C31H35NO3.C7H17NO5/c1-3-5-6-7-21-32(28-19-20-30(33)29(22-28)31(34)35)23-27-17-15-26(16-18-27)14-13-25-11-9-24(8-4-2)10-12-25;1-8-2-4(10)6(12)7(13)5(11)3-9/h9-12,15-20,22,33H,3-8,21,23H2,1-2H3,(H,34,35);4-13H,2-3H2,1H3/t;4-,5+,6+,7+/m.0/s1 |
| InChIKey | FBDDUVSZOCIZSN-WZTVWXICSA-N |
| XLogP | 3.67 |
| TPSA | 173.95 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.84 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|