C41H56N2O9 — CID 157298219
2-carboxy-5-[[N-(3,3-dimethylbutanoyl)-4-[2-(4-hexylphenyl)ethynyl]anilino]methyl]phenolate;methyl-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]azanium (PubChem CID 157298219) has the molecular formula C41H56N2O9 and a molecular weight of 720.90 g/mol. Its IUPAC name is 2-carboxy-5-[[N-(3,3-dimethylbutanoyl)-4-[2-(4-hexylphenyl)ethynyl]anilino]methyl]phenolate;methyl-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]azanium.
| Compound Name | 2-carboxy-5-[[N-(3,3-dimethylbutanoyl)-4-[2-(4-hexylphenyl)ethynyl]anilino]methyl]phenolate;methyl-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]azanium |
|---|---|
| PubChem CID | 157298219 |
| Molecular Formula | C41H56N2O9 |
| Molecular Weight | 720.90 g/mol |
| Exact Mass | 720.40 |
| IUPAC Name | 2-carboxy-5-[[N-(3,3-dimethylbutanoyl)-4-[2-(4-hexylphenyl)ethynyl]anilino]methyl]phenolate;methyl-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]azanium |
| SMILES | CCCCCCc1ccc(C#Cc2ccc(N(Cc3ccc(C(=O)O)c([O-])c3)C(=O)CC(C)(C)C)cc2)cc1.C[NH2+]C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C34H39NO4.C7H17NO5/c1-5-6-7-8-9-25-10-12-26(13-11-25)14-15-27-16-19-29(20-17-27)35(32(37)23-34(2,3)4)24-28-18-21-30(33(38)39)31(36)22-28;1-8-2-4(10)6(12)7(13)5(11)3-9/h10-13,16-22,36H,5-9,23-24H2,1-4H3,(H,38,39);4-13H,2-3H2,1H3/t;4-,5+,6+,7+/m.0/s1 |
| InChIKey | BBOYKZIZPOTDDK-WZTVWXICSA-N |
| XLogP | 2.57 |
| TPSA | 198.43 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.90 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|