C39H53FN2O7 — CID 158701175
5-[[4-[2-(4-butylphenyl)ethynyl]-N-hexylanilino]methyl]-2-fluorobenzoate;methyl-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]azanium (PubChem CID 158701175) has the molecular formula C39H53FN2O7 and a molecular weight of 680.86 g/mol. Its IUPAC name is 5-[[4-[2-(4-butylphenyl)ethynyl]-N-hexylanilino]methyl]-2-fluorobenzoate;methyl-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]azanium.
| Compound Name | 5-[[4-[2-(4-butylphenyl)ethynyl]-N-hexylanilino]methyl]-2-fluorobenzoate;methyl-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]azanium |
|---|---|
| PubChem CID | 158701175 |
| Molecular Formula | C39H53FN2O7 |
| Molecular Weight | 680.86 g/mol |
| Exact Mass | 680.38 |
| IUPAC Name | 5-[[4-[2-(4-butylphenyl)ethynyl]-N-hexylanilino]methyl]-2-fluorobenzoate;methyl-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]azanium |
| SMILES | CCCCCCN(Cc1ccc(F)c(C(=O)[O-])c1)c1ccc(C#Cc2ccc(CCCC)cc2)cc1.C[NH2+]C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C32H36FNO2.C7H17NO5/c1-3-5-7-8-22-34(24-28-18-21-31(33)30(23-28)32(35)36)29-19-16-27(17-20-29)15-14-26-12-10-25(11-13-26)9-6-4-2;1-8-2-4(10)6(12)7(13)5(11)3-9/h10-13,16-21,23H,3-9,22,24H2,1-2H3,(H,35,36);4-13H,2-3H2,1H3/t;4-,5+,6+,7+/m.0/s1 |
| InChIKey | IHOHZXPLUVDKKM-WZTVWXICSA-N |
| XLogP | 2.13 |
| TPSA | 161.13 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.86 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|