C45H59NO6 — CID 58721225
2,5-bis[2-(4-octylphenyl)ethynyl]-N-[(2S,3S,4R,5S)-2,3,4,5,6-pentahydroxyhexyl]benzamide (PubChem CID 58721225) has the molecular formula C45H59NO6 and a molecular weight of 709.97 g/mol. Its IUPAC name is 2,5-bis[2-(4-octylphenyl)ethynyl]-N-[(2S,3S,4R,5S)-2,3,4,5,6-pentahydroxyhexyl]benzamide.
| Compound Name | 2,5-bis[2-(4-octylphenyl)ethynyl]-N-[(2S,3S,4R,5S)-2,3,4,5,6-pentahydroxyhexyl]benzamide |
|---|---|
| PubChem CID | 58721225 |
| Molecular Formula | C45H59NO6 |
| Molecular Weight | 709.97 g/mol |
| Exact Mass | 709.43 |
| IUPAC Name | 2,5-bis[2-(4-octylphenyl)ethynyl]-N-[(2S,3S,4R,5S)-2,3,4,5,6-pentahydroxyhexyl]benzamide |
| SMILES | CCCCCCCCc1ccc(C#Cc2ccc(C#Cc3ccc(CCCCCCCC)cc3)c(C(=O)NC[C@H](O)[C@H](O)[C@H](O)[C@@H](O)CO)c2)cc1 |
| InChI | InChI=1S/C45H59NO6/c1-3-5-7-9-11-13-15-34-17-21-36(22-18-34)25-26-38-28-30-39(29-27-37-23-19-35(20-24-37)16-14-12-10-8-6-4-2)40(31-38)45(52)46-32-41(48)43(50)44(51)42(49)33-47/h17-24,28,30-31,41-44,47-51H,3-16,32-33H2,1-2H3,(H,46,52)/t41-,42-,43-,44+/m0/s1 |
| InChIKey | DGOAOTZIEGYEBM-LNYMGSRYSA-N |
| XLogP | 6.46 |
| TPSA | 130.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.97 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|