C32H34FNO2 — CID 141168377
5-[[4-[2-(4-butylphenyl)ethynyl]phenyl]methyl-(3,3-dimethylbut-1-enyl)amino]-2-fluorobenzoic acid (PubChem CID 141168377) has the molecular formula C32H34FNO2 and a molecular weight of 483.63 g/mol. Its IUPAC name is 5-[[4-[2-(4-butylphenyl)ethynyl]phenyl]methyl-(3,3-dimethylbut-1-enyl)amino]-2-fluorobenzoic acid.
| Compound Name | 5-[[4-[2-(4-butylphenyl)ethynyl]phenyl]methyl-(3,3-dimethylbut-1-enyl)amino]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 141168377 |
| Molecular Formula | C32H34FNO2 |
| Molecular Weight | 483.63 g/mol |
| Exact Mass | 483.26 |
| IUPAC Name | 5-[[4-[2-(4-butylphenyl)ethynyl]phenyl]methyl-(3,3-dimethylbut-1-enyl)amino]-2-fluorobenzoic acid |
| SMILES | CCCCc1ccc(C#Cc2ccc(CN(C=CC(C)(C)C)c3ccc(F)c(C(=O)O)c3)cc2)cc1 |
| InChI | InChI=1S/C32H34FNO2/c1-5-6-7-24-8-10-25(11-9-24)12-13-26-14-16-27(17-15-26)23-34(21-20-32(2,3)4)28-18-19-30(33)29(22-28)31(35)36/h8-11,14-22H,5-7,23H2,1-4H3,(H,35,36) |
| InChIKey | SMDBYCPUUCWCAX-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.63 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|