C26H24FNO2 — CID 67171770
5-[[4-[2-(4-butylphenyl)ethynyl]phenyl]methylamino]-2-fluorobenzoic acid (PubChem CID 67171770) has the molecular formula C26H24FNO2 and a molecular weight of 401.48 g/mol. Its IUPAC name is 5-[[4-[2-(4-butylphenyl)ethynyl]phenyl]methylamino]-2-fluorobenzoic acid.
| Compound Name | 5-[[4-[2-(4-butylphenyl)ethynyl]phenyl]methylamino]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 67171770 |
| Molecular Formula | C26H24FNO2 |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 5-[[4-[2-(4-butylphenyl)ethynyl]phenyl]methylamino]-2-fluorobenzoic acid |
| SMILES | CCCCc1ccc(C#Cc2ccc(CNc3ccc(F)c(C(=O)O)c3)cc2)cc1 |
| InChI | InChI=1S/C26H24FNO2/c1-2-3-4-19-5-7-20(8-6-19)9-10-21-11-13-22(14-12-21)18-28-23-15-16-25(27)24(17-23)26(29)30/h5-8,11-17,28H,2-4,18H2,1H3,(H,29,30) |
| InChIKey | GNWKJAVARPGJIJ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|