C29H29NO3 — CID 11419288
7-[[4-[2-(4-butylphenyl)ethynyl]phenyl]methylamino]-2,2-dimethyl-1,3-benzodioxin-4-one (PubChem CID 11419288) has the molecular formula C29H29NO3 and a molecular weight of 439.56 g/mol. Its IUPAC name is 7-[[4-[2-(4-butylphenyl)ethynyl]phenyl]methylamino]-2,2-dimethyl-1,3-benzodioxin-4-one.
| Compound Name | 7-[[4-[2-(4-butylphenyl)ethynyl]phenyl]methylamino]-2,2-dimethyl-1,3-benzodioxin-4-one |
|---|---|
| PubChem CID | 11419288 |
| Molecular Formula | C29H29NO3 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | 7-[[4-[2-(4-butylphenyl)ethynyl]phenyl]methylamino]-2,2-dimethyl-1,3-benzodioxin-4-one |
| SMILES | CCCCc1ccc(C#Cc2ccc(CNc3ccc4c(c3)OC(C)(C)OC4=O)cc2)cc1 |
| InChI | InChI=1S/C29H29NO3/c1-4-5-6-21-7-9-22(10-8-21)11-12-23-13-15-24(16-14-23)20-30-25-17-18-26-27(19-25)32-29(2,3)33-28(26)31/h7-10,13-19,30H,4-6,20H2,1-3H3 |
| InChIKey | WXQXZMOKIKAWPD-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|