C35H41NO3 — CID 69469641
5-[[4-[2-(4-butylphenyl)ethynyl]phenyl]methyl-hexylamino]-2,2-dimethyl-1,3-benzodioxin-4-one (PubChem CID 69469641) has the molecular formula C35H41NO3 and a molecular weight of 523.72 g/mol. Its IUPAC name is 5-[[4-[2-(4-butylphenyl)ethynyl]phenyl]methyl-hexylamino]-2,2-dimethyl-1,3-benzodioxin-4-one.
| Compound Name | 5-[[4-[2-(4-butylphenyl)ethynyl]phenyl]methyl-hexylamino]-2,2-dimethyl-1,3-benzodioxin-4-one |
|---|---|
| PubChem CID | 69469641 |
| Molecular Formula | C35H41NO3 |
| Molecular Weight | 523.72 g/mol |
| Exact Mass | 523.31 |
| IUPAC Name | 5-[[4-[2-(4-butylphenyl)ethynyl]phenyl]methyl-hexylamino]-2,2-dimethyl-1,3-benzodioxin-4-one |
| SMILES | CCCCCCN(Cc1ccc(C#Cc2ccc(CCCC)cc2)cc1)c1cccc2c1C(=O)OC(C)(C)O2 |
| InChI | InChI=1S/C35H41NO3/c1-5-7-9-10-25-36(31-13-11-14-32-33(31)34(37)39-35(3,4)38-32)26-30-23-21-29(22-24-30)20-19-28-17-15-27(16-18-28)12-8-6-2/h11,13-18,21-24H,5-10,12,25-26H2,1-4H3 |
| InChIKey | XUHOPWHLTZQCDO-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.72 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|