C27H30FNO2 — CID 142994793
N-[[4-(4-butylphenyl)-2-fluorophenyl]methyl]-2,2-dimethyl-4H-1,3-benzodioxin-6-amine (PubChem CID 142994793) has the molecular formula C27H30FNO2 and a molecular weight of 419.54 g/mol. Its IUPAC name is N-[[4-(4-butylphenyl)-2-fluorophenyl]methyl]-2,2-dimethyl-4H-1,3-benzodioxin-6-amine.
| Compound Name | N-[[4-(4-butylphenyl)-2-fluorophenyl]methyl]-2,2-dimethyl-4H-1,3-benzodioxin-6-amine |
|---|---|
| PubChem CID | 142994793 |
| Molecular Formula | C27H30FNO2 |
| Molecular Weight | 419.54 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | N-[[4-(4-butylphenyl)-2-fluorophenyl]methyl]-2,2-dimethyl-4H-1,3-benzodioxin-6-amine |
| SMILES | CCCCc1ccc(-c2ccc(CNc3ccc4c(c3)COC(C)(C)O4)c(F)c2)cc1 |
| InChI | InChI=1S/C27H30FNO2/c1-4-5-6-19-7-9-20(10-8-19)21-11-12-22(25(28)16-21)17-29-24-13-14-26-23(15-24)18-30-27(2,3)31-26/h7-16,29H,4-6,17-18H2,1-3H3 |
| InChIKey | XGVLSXFLQGHTIB-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.54 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|