C39H41NO4 — CID 11180816
5-[[4-[2-(4-butylphenyl)ethynyl]phenyl]methyl-(4-hexylbenzoyl)amino]-2-hydroxybenzoic acid (PubChem CID 11180816) has the molecular formula C39H41NO4 and a molecular weight of 587.76 g/mol. Its IUPAC name is 5-[[4-[2-(4-butylphenyl)ethynyl]phenyl]methyl-(4-hexylbenzoyl)amino]-2-hydroxybenzoic acid.
| Compound Name | 5-[[4-[2-(4-butylphenyl)ethynyl]phenyl]methyl-(4-hexylbenzoyl)amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 11180816 |
| Molecular Formula | C39H41NO4 |
| Molecular Weight | 587.76 g/mol |
| Exact Mass | 587.30 |
| IUPAC Name | 5-[[4-[2-(4-butylphenyl)ethynyl]phenyl]methyl-(4-hexylbenzoyl)amino]-2-hydroxybenzoic acid |
| SMILES | CCCCCCc1ccc(C(=O)N(Cc2ccc(C#Cc3ccc(CCCC)cc3)cc2)c2ccc(O)c(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C39H41NO4/c1-3-5-7-8-10-30-21-23-34(24-22-30)38(42)40(35-25-26-37(41)36(27-35)39(43)44)28-33-19-17-32(18-20-33)16-15-31-13-11-29(12-14-31)9-6-4-2/h11-14,17-27,41H,3-10,28H2,1-2H3,(H,43,44) |
| InChIKey | NCTZDIJHLFIIDR-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.76 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|