C32H35NO5 — CID 11318246
5-[(4-dec-1-ynylphenyl)methyl-(2-phenoxyacetyl)amino]-2-hydroxybenzoic acid (PubChem CID 11318246) has the molecular formula C32H35NO5 and a molecular weight of 513.63 g/mol. Its IUPAC name is 5-[(4-dec-1-ynylphenyl)methyl-(2-phenoxyacetyl)amino]-2-hydroxybenzoic acid.
| Compound Name | 5-[(4-dec-1-ynylphenyl)methyl-(2-phenoxyacetyl)amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 11318246 |
| Molecular Formula | C32H35NO5 |
| Molecular Weight | 513.63 g/mol |
| Exact Mass | 513.25 |
| IUPAC Name | 5-[(4-dec-1-ynylphenyl)methyl-(2-phenoxyacetyl)amino]-2-hydroxybenzoic acid |
| SMILES | CCCCCCCCC#Cc1ccc(CN(C(=O)COc2ccccc2)c2ccc(O)c(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C32H35NO5/c1-2-3-4-5-6-7-8-10-13-25-16-18-26(19-17-25)23-33(27-20-21-30(34)29(22-27)32(36)37)31(35)24-38-28-14-11-9-12-15-28/h9,11-12,14-22,34H,2-8,23-24H2,1H3,(H,36,37) |
| InChIKey | AAYWYGRJTMLQQK-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.63 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|