C32H37NO5S — CID 69463957
5-[1-[4-[2-(4-butylphenyl)ethynyl]phenyl]heptan-2-ylsulfamoyl]-2-hydroxybenzoic acid (PubChem CID 69463957) has the molecular formula C32H37NO5S and a molecular weight of 547.72 g/mol. Its IUPAC name is 5-[1-[4-[2-(4-butylphenyl)ethynyl]phenyl]heptan-2-ylsulfamoyl]-2-hydroxybenzoic acid.
| Compound Name | 5-[1-[4-[2-(4-butylphenyl)ethynyl]phenyl]heptan-2-ylsulfamoyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 69463957 |
| Molecular Formula | C32H37NO5S |
| Molecular Weight | 547.72 g/mol |
| Exact Mass | 547.24 |
| IUPAC Name | 5-[1-[4-[2-(4-butylphenyl)ethynyl]phenyl]heptan-2-ylsulfamoyl]-2-hydroxybenzoic acid |
| SMILES | CCCCCC(Cc1ccc(C#Cc2ccc(CCCC)cc2)cc1)NS(=O)(=O)c1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C32H37NO5S/c1-3-5-7-9-28(33-39(37,38)29-20-21-31(34)30(23-29)32(35)36)22-27-18-16-26(17-19-27)15-14-25-12-10-24(11-13-25)8-6-4-2/h10-13,16-21,23,28,33-34H,3-9,22H2,1-2H3,(H,35,36) |
| InChIKey | SNQFLIAECZGLKJ-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.72 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|