C30H33FN2O2 — CID 150081562
[5-[[4-[2-(4-ethylphenyl)ethynyl]phenyl]methyl-hexylamino]-2-fluorophenyl] carbamate (PubChem CID 150081562) has the molecular formula C30H33FN2O2 and a molecular weight of 472.60 g/mol. Its IUPAC name is [5-[[4-[2-(4-ethylphenyl)ethynyl]phenyl]methyl-hexylamino]-2-fluorophenyl] carbamate.
| Compound Name | [5-[[4-[2-(4-ethylphenyl)ethynyl]phenyl]methyl-hexylamino]-2-fluorophenyl] carbamate |
|---|---|
| PubChem CID | 150081562 |
| Molecular Formula | C30H33FN2O2 |
| Molecular Weight | 472.60 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | [5-[[4-[2-(4-ethylphenyl)ethynyl]phenyl]methyl-hexylamino]-2-fluorophenyl] carbamate |
| SMILES | CCCCCCN(Cc1ccc(C#Cc2ccc(CC)cc2)cc1)c1ccc(F)c(OC(N)=O)c1 |
| InChI | InChI=1S/C30H33FN2O2/c1-3-5-6-7-20-33(27-18-19-28(31)29(21-27)35-30(32)34)22-26-16-14-25(15-17-26)13-12-24-10-8-23(4-2)9-11-24/h8-11,14-19,21H,3-7,20,22H2,1-2H3,(H2,32,34) |
| InChIKey | DRJHJGKRGAXLGN-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.60 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|