C27H34F3N — CID 102578784
N,N-dihexyl-4-[2-[4-(trifluoromethyl)phenyl]ethynyl]aniline (PubChem CID 102578784) has the molecular formula C27H34F3N and a molecular weight of 429.57 g/mol. Its IUPAC name is N,N-dihexyl-4-[2-[4-(trifluoromethyl)phenyl]ethynyl]aniline.
| Compound Name | N,N-dihexyl-4-[2-[4-(trifluoromethyl)phenyl]ethynyl]aniline |
|---|---|
| PubChem CID | 102578784 |
| Molecular Formula | C27H34F3N |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 429.26 |
| IUPAC Name | N,N-dihexyl-4-[2-[4-(trifluoromethyl)phenyl]ethynyl]aniline |
| SMILES | CCCCCCN(CCCCCC)c1ccc(C#Cc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C27H34F3N/c1-3-5-7-9-21-31(22-10-8-6-4-2)26-19-15-24(16-20-26)12-11-23-13-17-25(18-14-23)27(28,29)30/h13-20H,3-10,21-22H2,1-2H3 |
| InChIKey | RVDNDWAGDJKGMV-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|