C37H49NO9 — CID 160690259
5-[1-[4-[2-(4-butylphenyl)ethynyl]phenyl]pentoxy]-2-carboxyphenolate;methyl-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]azanium (PubChem CID 160690259) has the molecular formula C37H49NO9 and a molecular weight of 651.80 g/mol. Its IUPAC name is 5-[1-[4-[2-(4-butylphenyl)ethynyl]phenyl]pentoxy]-2-carboxyphenolate;methyl-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]azanium.
| Compound Name | 5-[1-[4-[2-(4-butylphenyl)ethynyl]phenyl]pentoxy]-2-carboxyphenolate;methyl-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]azanium |
|---|---|
| PubChem CID | 160690259 |
| Molecular Formula | C37H49NO9 |
| Molecular Weight | 651.80 g/mol |
| Exact Mass | 651.34 |
| IUPAC Name | 5-[1-[4-[2-(4-butylphenyl)ethynyl]phenyl]pentoxy]-2-carboxyphenolate;methyl-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]azanium |
| SMILES | CCCCc1ccc(C#Cc2ccc(C(CCCC)Oc3ccc(C(=O)O)c([O-])c3)cc2)cc1.C[NH2+]C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C30H32O4.C7H17NO5/c1-3-5-7-22-9-11-23(12-10-22)13-14-24-15-17-25(18-16-24)29(8-6-4-2)34-26-19-20-27(30(32)33)28(31)21-26;1-8-2-4(10)6(12)7(13)5(11)3-9/h9-12,15-21,29,31H,3-8H2,1-2H3,(H,32,33);4-13H,2-3H2,1H3/t;4-,5+,6+,7+/m.0/s1 |
| InChIKey | RPHVIGPPBNXLDK-WZTVWXICSA-N |
| XLogP | 2.13 |
| TPSA | 187.35 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.80 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|