About [4-[2-(4-butylphenyl)ethynyl]phenyl] (2S)-2-phenylpropanoate
[4-[2-(4-butylphenyl)ethynyl]phenyl] (2S)-2-phenylpropanoate (PubChem CID 177385008) has the molecular formula C27H26O2
and a molecular weight of 382.50 g/mol. Its IUPAC name is [4-[2-(4-butylphenyl)ethynyl]phenyl] (2S)-2-phenylpropanoate.
Molecular Properties
| Compound Name | [4-[2-(4-butylphenyl)ethynyl]phenyl] (2S)-2-phenylpropanoate |
| PubChem CID | 177385008 |
| Molecular Formula | C27H26O2 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | [4-[2-(4-butylphenyl)ethynyl]phenyl] (2S)-2-phenylpropanoate |
| SMILES | CCCCc1ccc(C#Cc2ccc(OC(=O)[C@@H](C)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C27H26O2/c1-3-4-8-22-11-13-23(14-12-22)15-16-24-17-19-26(20-18-24)29-27(28)21(2)25-9-6-5-7-10-25/h5-7,9-14,17-21H,3-4,8H2,1-2H3/t21-/m0/s1 |
| InChIKey | IHKNJRLXUGYIOS-NRFANRHFSA-N |
| XLogP | 6.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-[2-(4-butylphenyl)ethynyl]phenyl] (2S)-2-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-(4-butylphenyl)ethynyl]phenyl] (2S)-2-phenylpropanoate?
The IUPAC name of [4-[2-(4-butylphenyl)ethynyl]phenyl] (2S)-2-phenylpropanoate (CID 177385008) is [4-[2-(4-butylphenyl)ethynyl]phenyl] (2S)-2-phenylpropanoate.
What is the SMILES notation for [4-[2-(4-butylphenyl)ethynyl]phenyl] (2S)-2-phenylpropanoate?
The canonical SMILES for [4-[2-(4-butylphenyl)ethynyl]phenyl] (2S)-2-phenylpropanoate is CCCCc1ccc(C#Cc2ccc(OC(=O)[C@@H](C)c3ccccc3)cc2)cc1.
What is the InChIKey of [4-[2-(4-butylphenyl)ethynyl]phenyl] (2S)-2-phenylpropanoate?
The InChIKey is IHKNJRLXUGYIOS-NRFANRHFSA-N. The full InChI is InChI=1S/C27H26O2/c1-3-4-8-22-11-13-23(14-12-22)15-16-24-17-19-26(20-18-24)29-27(28)21(2)25-9-6-5-7-10-25/h5-7,9-14,17-21H,3-4,8H2,1-2H3/t21-/m0/s1.
What are the key properties of [4-[2-(4-butylphenyl)ethynyl]phenyl] (2S)-2-phenylpropanoate?
[4-[2-(4-butylphenyl)ethynyl]phenyl] (2S)-2-phenylpropanoate has a molecular weight of 382.50 g/mol, XLogP of 6.14, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-(4-butylphenyl)ethynyl]phenyl] (2S)-2-phenylpropanoate is sourced from PubChem (CID 177385008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).