C22H25NO2 — CID 67742911
2-ethyl-6-[2-[4-(4-methylpentyl)phenyl]ethynyl]pyridine-3-carboxylic acid (PubChem CID 67742911) has the molecular formula C22H25NO2 and a molecular weight of 335.45 g/mol. Its IUPAC name is 2-ethyl-6-[2-[4-(4-methylpentyl)phenyl]ethynyl]pyridine-3-carboxylic acid.
| Compound Name | 2-ethyl-6-[2-[4-(4-methylpentyl)phenyl]ethynyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 67742911 |
| Molecular Formula | C22H25NO2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | 2-ethyl-6-[2-[4-(4-methylpentyl)phenyl]ethynyl]pyridine-3-carboxylic acid |
| SMILES | CCc1nc(C#Cc2ccc(CCCC(C)C)cc2)ccc1C(=O)O |
| InChI | InChI=1S/C22H25NO2/c1-4-21-20(22(24)25)15-14-19(23-21)13-12-18-10-8-17(9-11-18)7-5-6-16(2)3/h8-11,14-16H,4-7H2,1-3H3,(H,24,25) |
| InChIKey | KUPDLUOOBDZOON-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|