C34H38NO4- — CID 142994788
[5-[[4-[2-(4-butylphenyl)ethynyl]phenyl]methyl-(3-cyclopentylpropanoyl)amino]-2-hydroxyphenyl]-hydroxymethanolate (PubChem CID 142994788) has the molecular formula C34H38NO4- and a molecular weight of 524.68 g/mol. Its IUPAC name is [5-[[4-[2-(4-butylphenyl)ethynyl]phenyl]methyl-(3-cyclopentylpropanoyl)amino]-2-hydroxyphenyl]-hydroxymethanolate.
| Compound Name | [5-[[4-[2-(4-butylphenyl)ethynyl]phenyl]methyl-(3-cyclopentylpropanoyl)amino]-2-hydroxyphenyl]-hydroxymethanolate |
|---|---|
| PubChem CID | 142994788 |
| Molecular Formula | C34H38NO4- |
| Molecular Weight | 524.68 g/mol |
| Exact Mass | 524.28 |
| IUPAC Name | [5-[[4-[2-(4-butylphenyl)ethynyl]phenyl]methyl-(3-cyclopentylpropanoyl)amino]-2-hydroxyphenyl]-hydroxymethanolate |
| SMILES | CCCCc1ccc(C#Cc2ccc(CN(C(=O)CCC3CCCC3)c3ccc(O)c(C([O-])O)c3)cc2)cc1 |
| InChI | InChI=1S/C34H38NO4/c1-2-3-6-26-9-11-27(12-10-26)13-14-28-15-17-29(18-16-28)24-35(33(37)22-19-25-7-4-5-8-25)30-20-21-32(36)31(23-30)34(38)39/h9-12,15-18,20-21,23,25,34,36,38H,2-8,19,22,24H2,1H3/q-1 |
| InChIKey | IRAQOVOXWBELQQ-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.68 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|