C35H42N2O5 — CID 69329548
3-[3-cyclopentylpropanoyl-[[4-[(4-pentylphenyl)methylcarbamoyl]phenyl]methyl]amino]-2-hydroxybenzoic acid (PubChem CID 69329548) has the molecular formula C35H42N2O5 and a molecular weight of 570.73 g/mol. Its IUPAC name is 3-[3-cyclopentylpropanoyl-[[4-[(4-pentylphenyl)methylcarbamoyl]phenyl]methyl]amino]-2-hydroxybenzoic acid.
| Compound Name | 3-[3-cyclopentylpropanoyl-[[4-[(4-pentylphenyl)methylcarbamoyl]phenyl]methyl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 69329548 |
| Molecular Formula | C35H42N2O5 |
| Molecular Weight | 570.73 g/mol |
| Exact Mass | 570.31 |
| IUPAC Name | 3-[3-cyclopentylpropanoyl-[[4-[(4-pentylphenyl)methylcarbamoyl]phenyl]methyl]amino]-2-hydroxybenzoic acid |
| SMILES | CCCCCc1ccc(CNC(=O)c2ccc(CN(C(=O)CCC3CCCC3)c3cccc(C(=O)O)c3O)cc2)cc1 |
| InChI | InChI=1S/C35H42N2O5/c1-2-3-4-8-26-13-15-27(16-14-26)23-36-34(40)29-20-17-28(18-21-29)24-37(32(38)22-19-25-9-5-6-10-25)31-12-7-11-30(33(31)39)35(41)42/h7,11-18,20-21,25,39H,2-6,8-10,19,22-24H2,1H3,(H,36,40)(H,41,42) |
| InChIKey | HDSZNEXODIQLOS-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.73 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|