C35H37N3O5S — CID 11157791
2-hydroxy-5-[3-methylbut-2-enoyl-[[2-[4-[(4-pentylphenyl)methylcarbamoyl]phenyl]-1,3-thiazol-4-yl]methyl]amino]benzoic acid (PubChem CID 11157791) has the molecular formula C35H37N3O5S and a molecular weight of 611.76 g/mol. Its IUPAC name is 2-hydroxy-5-[3-methylbut-2-enoyl-[[2-[4-[(4-pentylphenyl)methylcarbamoyl]phenyl]-1,3-thiazol-4-yl]methyl]amino]benzoic acid.
| Compound Name | 2-hydroxy-5-[3-methylbut-2-enoyl-[[2-[4-[(4-pentylphenyl)methylcarbamoyl]phenyl]-1,3-thiazol-4-yl]methyl]amino]benzoic acid |
|---|---|
| PubChem CID | 11157791 |
| Molecular Formula | C35H37N3O5S |
| Molecular Weight | 611.76 g/mol |
| Exact Mass | 611.25 |
| IUPAC Name | 2-hydroxy-5-[3-methylbut-2-enoyl-[[2-[4-[(4-pentylphenyl)methylcarbamoyl]phenyl]-1,3-thiazol-4-yl]methyl]amino]benzoic acid |
| SMILES | CCCCCc1ccc(CNC(=O)c2ccc(-c3nc(CN(C(=O)C=C(C)C)c4ccc(O)c(C(=O)O)c4)cs3)cc2)cc1 |
| InChI | InChI=1S/C35H37N3O5S/c1-4-5-6-7-24-8-10-25(11-9-24)20-36-33(41)26-12-14-27(15-13-26)34-37-28(22-44-34)21-38(32(40)18-23(2)3)29-16-17-31(39)30(19-29)35(42)43/h8-19,22,39H,4-7,20-21H2,1-3H3,(H,36,41)(H,42,43) |
| InChIKey | RIEGSJMQHPNZED-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 119.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.76 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|