C39H39N3O5S — CID 11365843
2-[4-[[[2-[4-(4-phenylbutylcarbamoyl)phenyl]-1,3-thiazol-4-yl]methyl-(3-phenylpropanoyl)amino]methyl]phenoxy]acetic acid (PubChem CID 11365843) has the molecular formula C39H39N3O5S and a molecular weight of 661.82 g/mol. Its IUPAC name is 2-[4-[[[2-[4-(4-phenylbutylcarbamoyl)phenyl]-1,3-thiazol-4-yl]methyl-(3-phenylpropanoyl)amino]methyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[[[2-[4-(4-phenylbutylcarbamoyl)phenyl]-1,3-thiazol-4-yl]methyl-(3-phenylpropanoyl)amino]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 11365843 |
| Molecular Formula | C39H39N3O5S |
| Molecular Weight | 661.82 g/mol |
| Exact Mass | 661.26 |
| IUPAC Name | 2-[4-[[[2-[4-(4-phenylbutylcarbamoyl)phenyl]-1,3-thiazol-4-yl]methyl-(3-phenylpropanoyl)amino]methyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(CN(Cc2csc(-c3ccc(C(=O)NCCCCc4ccccc4)cc3)n2)C(=O)CCc2ccccc2)cc1 |
| InChI | InChI=1S/C39H39N3O5S/c43-36(23-16-30-11-5-2-6-12-30)42(25-31-14-21-35(22-15-31)47-27-37(44)45)26-34-28-48-39(41-34)33-19-17-32(18-20-33)38(46)40-24-8-7-13-29-9-3-1-4-10-29/h1-6,9-12,14-15,17-22,28H,7-8,13,16,23-27H2,(H,40,46)(H,44,45) |
| InChIKey | QJUKKIDACQSTIB-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.82 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|