C39H37N3O5S — CID 91177184
2-[4-[[[3-phenyl-2-[[2-[4-(4-phenylbutylcarbamoyl)phenyl]-1,3-thiazol-4-yl]methyl]prop-2-enoyl]amino]methyl]phenoxy]acetic acid (PubChem CID 91177184) has the molecular formula C39H37N3O5S and a molecular weight of 659.81 g/mol. Its IUPAC name is 2-[4-[[[3-phenyl-2-[[2-[4-(4-phenylbutylcarbamoyl)phenyl]-1,3-thiazol-4-yl]methyl]prop-2-enoyl]amino]methyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[[[3-phenyl-2-[[2-[4-(4-phenylbutylcarbamoyl)phenyl]-1,3-thiazol-4-yl]methyl]prop-2-enoyl]amino]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 91177184 |
| Molecular Formula | C39H37N3O5S |
| Molecular Weight | 659.81 g/mol |
| Exact Mass | 659.25 |
| IUPAC Name | 2-[4-[[[3-phenyl-2-[[2-[4-(4-phenylbutylcarbamoyl)phenyl]-1,3-thiazol-4-yl]methyl]prop-2-enoyl]amino]methyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(CNC(=O)C(=Cc2ccccc2)Cc2csc(-c3ccc(C(=O)NCCCCc4ccccc4)cc3)n2)cc1 |
| InChI | InChI=1S/C39H37N3O5S/c43-36(44)26-47-35-20-14-30(15-21-35)25-41-38(46)33(23-29-12-5-2-6-13-29)24-34-27-48-39(42-34)32-18-16-31(17-19-32)37(45)40-22-8-7-11-28-9-3-1-4-10-28/h1-6,9-10,12-21,23,27H,7-8,11,22,24-26H2,(H,40,45)(H,41,46)(H,43,44) |
| InChIKey | DTZXZOCRHLTMEV-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 117.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.81 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|