C37H30N2O6 — CID 11433372
2-hydroxy-5-[[4-[(4-phenoxyphenyl)methylcarbamoyl]phenyl]methyl-[(E)-3-phenylprop-2-enoyl]amino]benzoic acid (PubChem CID 11433372) has the molecular formula C37H30N2O6 and a molecular weight of 598.66 g/mol. Its IUPAC name is 2-hydroxy-5-[[4-[(4-phenoxyphenyl)methylcarbamoyl]phenyl]methyl-[(E)-3-phenylprop-2-enoyl]amino]benzoic acid.
| Compound Name | 2-hydroxy-5-[[4-[(4-phenoxyphenyl)methylcarbamoyl]phenyl]methyl-[(E)-3-phenylprop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 11433372 |
| Molecular Formula | C37H30N2O6 |
| Molecular Weight | 598.66 g/mol |
| Exact Mass | 598.21 |
| IUPAC Name | 2-hydroxy-5-[[4-[(4-phenoxyphenyl)methylcarbamoyl]phenyl]methyl-[(E)-3-phenylprop-2-enoyl]amino]benzoic acid |
| SMILES | O=C(NCc1ccc(Oc2ccccc2)cc1)c1ccc(CN(C(=O)/C=C/c2ccccc2)c2ccc(O)c(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C37H30N2O6/c40-34-21-18-30(23-33(34)37(43)44)39(35(41)22-15-26-7-3-1-4-8-26)25-28-11-16-29(17-12-28)36(42)38-24-27-13-19-32(20-14-27)45-31-9-5-2-6-10-31/h1-23,40H,24-25H2,(H,38,42)(H,43,44)/b22-15+ |
| InChIKey | DZDSZFDDLDHYAH-PXLXIMEGSA-N |
| XLogP | 7.06 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.66 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|