C36H27F3N2O6 — CID 90687999
2-hydroxy-5-[[2-[[4-[(4-phenoxyphenyl)methylcarbamoyl]phenyl]methyl]-4-(trifluoromethyl)benzoyl]amino]benzoic acid (PubChem CID 90687999) has the molecular formula C36H27F3N2O6 and a molecular weight of 640.61 g/mol. Its IUPAC name is 2-hydroxy-5-[[2-[[4-[(4-phenoxyphenyl)methylcarbamoyl]phenyl]methyl]-4-(trifluoromethyl)benzoyl]amino]benzoic acid.
| Compound Name | 2-hydroxy-5-[[2-[[4-[(4-phenoxyphenyl)methylcarbamoyl]phenyl]methyl]-4-(trifluoromethyl)benzoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 90687999 |
| Molecular Formula | C36H27F3N2O6 |
| Molecular Weight | 640.61 g/mol |
| Exact Mass | 640.18 |
| IUPAC Name | 2-hydroxy-5-[[2-[[4-[(4-phenoxyphenyl)methylcarbamoyl]phenyl]methyl]-4-(trifluoromethyl)benzoyl]amino]benzoic acid |
| SMILES | O=C(NCc1ccc(Oc2ccccc2)cc1)c1ccc(Cc2cc(C(F)(F)F)ccc2C(=O)Nc2ccc(O)c(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C36H27F3N2O6/c37-36(38,39)26-12-16-30(34(44)41-27-13-17-32(42)31(20-27)35(45)46)25(19-26)18-22-6-10-24(11-7-22)33(43)40-21-23-8-14-29(15-9-23)47-28-4-2-1-3-5-28/h1-17,19-20,42H,18,21H2,(H,40,43)(H,41,44)(H,45,46) |
| InChIKey | SYMAVIYPSBKOQZ-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.61 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|