C29H25NO6 — CID 118370961
2-hydroxy-5-[(3-methoxy-4-methylphenyl)methyl-(4-phenoxybenzoyl)amino]benzoic acid (PubChem CID 118370961) has the molecular formula C29H25NO6 and a molecular weight of 483.52 g/mol. Its IUPAC name is 2-hydroxy-5-[(3-methoxy-4-methylphenyl)methyl-(4-phenoxybenzoyl)amino]benzoic acid.
| Compound Name | 2-hydroxy-5-[(3-methoxy-4-methylphenyl)methyl-(4-phenoxybenzoyl)amino]benzoic acid |
|---|---|
| PubChem CID | 118370961 |
| Molecular Formula | C29H25NO6 |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | 2-hydroxy-5-[(3-methoxy-4-methylphenyl)methyl-(4-phenoxybenzoyl)amino]benzoic acid |
| SMILES | COc1cc(CN(C(=O)c2ccc(Oc3ccccc3)cc2)c2ccc(O)c(C(=O)O)c2)ccc1C |
| InChI | InChI=1S/C29H25NO6/c1-19-8-9-20(16-27(19)35-2)18-30(22-12-15-26(31)25(17-22)29(33)34)28(32)21-10-13-24(14-11-21)36-23-6-4-3-5-7-23/h3-17,31H,18H2,1-2H3,(H,33,34) |
| InChIKey | DLCXRKOTYSQNHK-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |