C30H25NO7 — CID 67767368
4-[(2-methoxyphenyl)methyl-[(4-phenoxyphenyl)methyl]carbamoyl]phthalic acid (PubChem CID 67767368) has the molecular formula C30H25NO7 and a molecular weight of 511.53 g/mol. Its IUPAC name is 4-[(2-methoxyphenyl)methyl-[(4-phenoxyphenyl)methyl]carbamoyl]phthalic acid.
| Compound Name | 4-[(2-methoxyphenyl)methyl-[(4-phenoxyphenyl)methyl]carbamoyl]phthalic acid |
|---|---|
| PubChem CID | 67767368 |
| Molecular Formula | C30H25NO7 |
| Molecular Weight | 511.53 g/mol |
| Exact Mass | 511.16 |
| IUPAC Name | 4-[(2-methoxyphenyl)methyl-[(4-phenoxyphenyl)methyl]carbamoyl]phthalic acid |
| SMILES | COc1ccccc1CN(Cc1ccc(Oc2ccccc2)cc1)C(=O)c1ccc(C(=O)O)c(C(=O)O)c1 |
| InChI | InChI=1S/C30H25NO7/c1-37-27-10-6-5-7-22(27)19-31(28(32)21-13-16-25(29(33)34)26(17-21)30(35)36)18-20-11-14-24(15-12-20)38-23-8-3-2-4-9-23/h2-17H,18-19H2,1H3,(H,33,34)(H,35,36) |
| InChIKey | NGRQPTNQEMLWNH-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.53 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |