C30H27NO5 — CID 67768058
methyl 3-[benzyl-[(4-phenoxyphenyl)methyl]carbamoyl]-5-(hydroxymethyl)benzoate (PubChem CID 67768058) has the molecular formula C30H27NO5 and a molecular weight of 481.55 g/mol. Its IUPAC name is methyl 3-[benzyl-[(4-phenoxyphenyl)methyl]carbamoyl]-5-(hydroxymethyl)benzoate.
| Compound Name | methyl 3-[benzyl-[(4-phenoxyphenyl)methyl]carbamoyl]-5-(hydroxymethyl)benzoate |
|---|---|
| PubChem CID | 67768058 |
| Molecular Formula | C30H27NO5 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | methyl 3-[benzyl-[(4-phenoxyphenyl)methyl]carbamoyl]-5-(hydroxymethyl)benzoate |
| SMILES | COC(=O)c1cc(CO)cc(C(=O)N(Cc2ccccc2)Cc2ccc(Oc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C30H27NO5/c1-35-30(34)26-17-24(21-32)16-25(18-26)29(33)31(19-22-8-4-2-5-9-22)20-23-12-14-28(15-13-23)36-27-10-6-3-7-11-27/h2-18,32H,19-21H2,1H3 |
| InChIKey | YVEGBUFZDVEYNN-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |