C30H26ClNO4 — CID 121482237
methyl 4-[[benzoyl-[2-[4-(3-chlorophenoxy)phenyl]ethyl]amino]methyl]benzoate (PubChem CID 121482237) has the molecular formula C30H26ClNO4 and a molecular weight of 499.99 g/mol. Its IUPAC name is methyl 4-[[benzoyl-[2-[4-(3-chlorophenoxy)phenyl]ethyl]amino]methyl]benzoate.
| Compound Name | methyl 4-[[benzoyl-[2-[4-(3-chlorophenoxy)phenyl]ethyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 121482237 |
| Molecular Formula | C30H26ClNO4 |
| Molecular Weight | 499.99 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | methyl 4-[[benzoyl-[2-[4-(3-chlorophenoxy)phenyl]ethyl]amino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN(CCc2ccc(Oc3cccc(Cl)c3)cc2)C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H26ClNO4/c1-35-30(34)25-14-10-23(11-15-25)21-32(29(33)24-6-3-2-4-7-24)19-18-22-12-16-27(17-13-22)36-28-9-5-8-26(31)20-28/h2-17,20H,18-19,21H2,1H3 |
| InChIKey | PSIYKCAOBQZQKE-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.99 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |