C30H27NO7 — CID 67398871
[2-hydroxy-5-[4-[[(3-methoxybenzoyl)-[(2-methoxyphenyl)methyl]amino]methyl]phenyl]phenyl] hydrogen carbonate (PubChem CID 67398871) has the molecular formula C30H27NO7 and a molecular weight of 513.55 g/mol. Its IUPAC name is [2-hydroxy-5-[4-[[(3-methoxybenzoyl)-[(2-methoxyphenyl)methyl]amino]methyl]phenyl]phenyl] hydrogen carbonate.
| Compound Name | [2-hydroxy-5-[4-[[(3-methoxybenzoyl)-[(2-methoxyphenyl)methyl]amino]methyl]phenyl]phenyl] hydrogen carbonate |
|---|---|
| PubChem CID | 67398871 |
| Molecular Formula | C30H27NO7 |
| Molecular Weight | 513.55 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | [2-hydroxy-5-[4-[[(3-methoxybenzoyl)-[(2-methoxyphenyl)methyl]amino]methyl]phenyl]phenyl] hydrogen carbonate |
| SMILES | COc1cccc(C(=O)N(Cc2ccc(-c3ccc(O)c(OC(=O)O)c3)cc2)Cc2ccccc2OC)c1 |
| InChI | InChI=1S/C30H27NO7/c1-36-25-8-5-7-23(16-25)29(33)31(19-24-6-3-4-9-27(24)37-2)18-20-10-12-21(13-11-20)22-14-15-26(32)28(17-22)38-30(34)35/h3-17,32H,18-19H2,1-2H3,(H,34,35) |
| InChIKey | XEGIIUODNKHPMA-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.55 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|