C38H48N2O10 — CID 11377463
4-[3-cyclopentylpropanoyl-[[4-[2-(4-methoxyphenyl)ethynyl]phenyl]methyl]amino]-2-hydroxybenzoic acid;(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol (PubChem CID 11377463) has the molecular formula C38H48N2O10 and a molecular weight of 692.81 g/mol. Its IUPAC name is 4-[3-cyclopentylpropanoyl-[[4-[2-(4-methoxyphenyl)ethynyl]phenyl]methyl]amino]-2-hydroxybenzoic acid;(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol.
| Compound Name | 4-[3-cyclopentylpropanoyl-[[4-[2-(4-methoxyphenyl)ethynyl]phenyl]methyl]amino]-2-hydroxybenzoic acid;(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 11377463 |
| Molecular Formula | C38H48N2O10 |
| Molecular Weight | 692.81 g/mol |
| Exact Mass | 692.33 |
| IUPAC Name | 4-[3-cyclopentylpropanoyl-[[4-[2-(4-methoxyphenyl)ethynyl]phenyl]methyl]amino]-2-hydroxybenzoic acid;(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol |
| SMILES | CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.COc1ccc(C#Cc2ccc(CN(C(=O)CCC3CCCC3)c3ccc(C(=O)O)c(O)c3)cc2)cc1 |
| InChI | InChI=1S/C31H31NO5.C7H17NO5/c1-37-27-16-12-24(13-17-27)7-6-23-8-10-25(11-9-23)21-32(30(34)19-14-22-4-2-3-5-22)26-15-18-28(31(35)36)29(33)20-26;1-8-2-4(10)6(12)7(13)5(11)3-9/h8-13,15-18,20,22,33H,2-5,14,19,21H2,1H3,(H,35,36);4-13H,2-3H2,1H3/t;4-,5+,6+,7+/m.0/s1 |
| InChIKey | JZXYTTKKXIVZQN-WZTVWXICSA-N |
| XLogP | 2.64 |
| TPSA | 200.25 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.81 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|