C28H30Cl3NO6 — CID 505727
2-chloro-4-[[4-(1-cyclohexyl-2-methylpropan-2-yl)oxy-3,4-dioxobutanoyl]-[(3,4-dichlorophenyl)methyl]amino]benzoic acid (PubChem CID 505727) has the molecular formula C28H30Cl3NO6 and a molecular weight of 582.91 g/mol. Its IUPAC name is 2-chloro-4-[[4-(1-cyclohexyl-2-methylpropan-2-yl)oxy-3,4-dioxobutanoyl]-[(3,4-dichlorophenyl)methyl]amino]benzoic acid.
| Compound Name | 2-chloro-4-[[4-(1-cyclohexyl-2-methylpropan-2-yl)oxy-3,4-dioxobutanoyl]-[(3,4-dichlorophenyl)methyl]amino]benzoic acid |
|---|---|
| PubChem CID | 505727 |
| Molecular Formula | C28H30Cl3NO6 |
| Molecular Weight | 582.91 g/mol |
| Exact Mass | 581.11 |
| IUPAC Name | 2-chloro-4-[[4-(1-cyclohexyl-2-methylpropan-2-yl)oxy-3,4-dioxobutanoyl]-[(3,4-dichlorophenyl)methyl]amino]benzoic acid |
| SMILES | CC(C)(CC1CCCCC1)OC(=O)C(=O)CC(=O)N(Cc1ccc(Cl)c(Cl)c1)c1ccc(C(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C28H30Cl3NO6/c1-28(2,15-17-6-4-3-5-7-17)38-27(37)24(33)14-25(34)32(16-18-8-11-21(29)23(31)12-18)19-9-10-20(26(35)36)22(30)13-19/h8-13,17H,3-7,14-16H2,1-2H3,(H,35,36) |
| InChIKey | DGHXPVQNIHWTHJ-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.91 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|