C25H28Cl2N2O5 — CID 505676
2-methylbutan-2-yl 4-[N-[(3,5-dichlorophenyl)methyl]-3-(dimethylcarbamoyl)anilino]-2,4-dioxobutanoate (PubChem CID 505676) has the molecular formula C25H28Cl2N2O5 and a molecular weight of 507.41 g/mol. Its IUPAC name is 2-methylbutan-2-yl 4-[N-[(3,5-dichlorophenyl)methyl]-3-(dimethylcarbamoyl)anilino]-2,4-dioxobutanoate.
| Compound Name | 2-methylbutan-2-yl 4-[N-[(3,5-dichlorophenyl)methyl]-3-(dimethylcarbamoyl)anilino]-2,4-dioxobutanoate |
|---|---|
| PubChem CID | 505676 |
| Molecular Formula | C25H28Cl2N2O5 |
| Molecular Weight | 507.41 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | 2-methylbutan-2-yl 4-[N-[(3,5-dichlorophenyl)methyl]-3-(dimethylcarbamoyl)anilino]-2,4-dioxobutanoate |
| SMILES | CCC(C)(C)OC(=O)C(=O)CC(=O)N(Cc1cc(Cl)cc(Cl)c1)c1cccc(C(=O)N(C)C)c1 |
| InChI | InChI=1S/C25H28Cl2N2O5/c1-6-25(2,3)34-24(33)21(30)14-22(31)29(15-16-10-18(26)13-19(27)11-16)20-9-7-8-17(12-20)23(32)28(4)5/h7-13H,6,14-15H2,1-5H3 |
| InChIKey | GGZPUGYXYRIECT-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.41 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|