C22H28Cl2N4O — CID 111670420
3-[2-[[[2-(3,5-dichlorophenyl)ethylamino]-(ethylamino)methylidene]amino]ethyl]-N,N-dimethylbenzamide (PubChem CID 111670420) has the molecular formula C22H28Cl2N4O and a molecular weight of 435.40 g/mol. Its IUPAC name is 3-[2-[[[2-(3,5-dichlorophenyl)ethylamino]-(ethylamino)methylidene]amino]ethyl]-N,N-dimethylbenzamide.
| Compound Name | 3-[2-[[[2-(3,5-dichlorophenyl)ethylamino]-(ethylamino)methylidene]amino]ethyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 111670420 |
| Molecular Formula | C22H28Cl2N4O |
| Molecular Weight | 435.40 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 3-[2-[[[2-(3,5-dichlorophenyl)ethylamino]-(ethylamino)methylidene]amino]ethyl]-N,N-dimethylbenzamide |
| SMILES | CCN/C(=N\CCc1cccc(C(=O)N(C)C)c1)NCCc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C22H28Cl2N4O/c1-4-25-22(27-11-9-17-13-19(23)15-20(24)14-17)26-10-8-16-6-5-7-18(12-16)21(29)28(2)3/h5-7,12-15H,4,8-11H2,1-3H3,(H2,25,26,27) |
| InChIKey | BYWGLHXUFNFRQO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.40 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|