C22H38N4O — CID 111668644
3-[2-[[N'-(5,5-dimethylhexyl)-N-ethylcarbamimidoyl]amino]ethyl]-N,N-dimethylbenzamide (PubChem CID 111668644) has the molecular formula C22H38N4O and a molecular weight of 374.57 g/mol. Its IUPAC name is 3-[2-[[N'-(5,5-dimethylhexyl)-N-ethylcarbamimidoyl]amino]ethyl]-N,N-dimethylbenzamide.
| Compound Name | 3-[2-[[N'-(5,5-dimethylhexyl)-N-ethylcarbamimidoyl]amino]ethyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 111668644 |
| Molecular Formula | C22H38N4O |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.30 |
| IUPAC Name | 3-[2-[[N'-(5,5-dimethylhexyl)-N-ethylcarbamimidoyl]amino]ethyl]-N,N-dimethylbenzamide |
| SMILES | CCN/C(=N\CCCCC(C)(C)C)NCCc1cccc(C(=O)N(C)C)c1 |
| InChI | InChI=1S/C22H38N4O/c1-7-23-21(24-15-9-8-14-22(2,3)4)25-16-13-18-11-10-12-19(17-18)20(27)26(5)6/h10-12,17H,7-9,13-16H2,1-6H3,(H2,23,24,25) |
| InChIKey | BNAHOQXZNOXFIH-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|