C25H37IN4O2 — CID 111670819
3-[2-[[N-ethyl-N'-(4-phenylmethoxybutyl)carbamimidoyl]amino]ethyl]-N,N-dimethylbenzamide;hydroiodide (PubChem CID 111670819) has the molecular formula C25H37IN4O2 and a molecular weight of 552.50 g/mol. Its IUPAC name is 3-[2-[[N-ethyl-N'-(4-phenylmethoxybutyl)carbamimidoyl]amino]ethyl]-N,N-dimethylbenzamide;hydroiodide.
| Compound Name | 3-[2-[[N-ethyl-N'-(4-phenylmethoxybutyl)carbamimidoyl]amino]ethyl]-N,N-dimethylbenzamide;hydroiodide |
|---|---|
| PubChem CID | 111670819 |
| Molecular Formula | C25H37IN4O2 |
| Molecular Weight | 552.50 g/mol |
| Exact Mass | 552.20 |
| IUPAC Name | 3-[2-[[N-ethyl-N'-(4-phenylmethoxybutyl)carbamimidoyl]amino]ethyl]-N,N-dimethylbenzamide;hydroiodide |
| SMILES | CCN/C(=N\CCCCOCc1ccccc1)NCCc1cccc(C(=O)N(C)C)c1.I |
| InChI | InChI=1S/C25H36N4O2.HI/c1-4-26-25(27-16-8-9-18-31-20-22-11-6-5-7-12-22)28-17-15-21-13-10-14-23(19-21)24(30)29(2)3;/h5-7,10-14,19H,4,8-9,15-18,20H2,1-3H3,(H2,26,27,28);1H |
| InChIKey | QVABOWLCPTXBCZ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.50 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|