C24H36IN3O3 — CID 111213506
1-[2-(3,4-dimethoxyphenyl)ethyl]-3-ethyl-2-(4-phenylmethoxybutyl)guanidine;hydroiodide (PubChem CID 111213506) has the molecular formula C24H36IN3O3 and a molecular weight of 541.47 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-ethyl-2-(4-phenylmethoxybutyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-ethyl-2-(4-phenylmethoxybutyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111213506 |
| Molecular Formula | C24H36IN3O3 |
| Molecular Weight | 541.47 g/mol |
| Exact Mass | 541.18 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-ethyl-2-(4-phenylmethoxybutyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCCOCc1ccccc1)NCCc1ccc(OC)c(OC)c1.I |
| InChI | InChI=1S/C24H35N3O3.HI/c1-4-25-24(26-15-8-9-17-30-19-21-10-6-5-7-11-21)27-16-14-20-12-13-22(28-2)23(18-20)29-3;/h5-7,10-13,18H,4,8-9,14-17,19H2,1-3H3,(H2,25,26,27);1H |
| InChIKey | DEHSJPAHJJWVEU-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.47 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|