C24H41N5O — CID 111669644
3-[2-[[N-ethyl-N'-[4-(4-methylpiperidin-1-yl)butyl]carbamimidoyl]amino]ethyl]-N,N-dimethylbenzamide (PubChem CID 111669644) has the molecular formula C24H41N5O and a molecular weight of 415.63 g/mol. Its IUPAC name is 3-[2-[[N-ethyl-N'-[4-(4-methylpiperidin-1-yl)butyl]carbamimidoyl]amino]ethyl]-N,N-dimethylbenzamide.
| Compound Name | 3-[2-[[N-ethyl-N'-[4-(4-methylpiperidin-1-yl)butyl]carbamimidoyl]amino]ethyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 111669644 |
| Molecular Formula | C24H41N5O |
| Molecular Weight | 415.63 g/mol |
| Exact Mass | 415.33 |
| IUPAC Name | 3-[2-[[N-ethyl-N'-[4-(4-methylpiperidin-1-yl)butyl]carbamimidoyl]amino]ethyl]-N,N-dimethylbenzamide |
| SMILES | CCN/C(=N\CCCCN1CCC(C)CC1)NCCc1cccc(C(=O)N(C)C)c1 |
| InChI | InChI=1S/C24H41N5O/c1-5-25-24(26-14-6-7-16-29-17-12-20(2)13-18-29)27-15-11-21-9-8-10-22(19-21)23(30)28(3)4/h8-10,19-20H,5-7,11-18H2,1-4H3,(H2,25,26,27) |
| InChIKey | WRCKUSRRPFMWSJ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.63 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|