C22H29FN4O — CID 111669460
3-[2-[[N-ethyl-N'-[2-(2-fluorophenyl)ethyl]carbamimidoyl]amino]ethyl]-N,N-dimethylbenzamide (PubChem CID 111669460) has the molecular formula C22H29FN4O and a molecular weight of 384.50 g/mol. Its IUPAC name is 3-[2-[[N-ethyl-N'-[2-(2-fluorophenyl)ethyl]carbamimidoyl]amino]ethyl]-N,N-dimethylbenzamide.
| Compound Name | 3-[2-[[N-ethyl-N'-[2-(2-fluorophenyl)ethyl]carbamimidoyl]amino]ethyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 111669460 |
| Molecular Formula | C22H29FN4O |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | 3-[2-[[N-ethyl-N'-[2-(2-fluorophenyl)ethyl]carbamimidoyl]amino]ethyl]-N,N-dimethylbenzamide |
| SMILES | CCN/C(=N\CCc1ccccc1F)NCCc1cccc(C(=O)N(C)C)c1 |
| InChI | InChI=1S/C22H29FN4O/c1-4-24-22(26-15-13-18-9-5-6-11-20(18)23)25-14-12-17-8-7-10-19(16-17)21(28)27(2)3/h5-11,16H,4,12-15H2,1-3H3,(H2,24,25,26) |
| InChIKey | GYZDBFHDVFABTJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|