C23H21ClN4O3 — CID 505205
3-[(4-chlorophenyl)methyl-(3-oxo-3-pyrimidin-2-ylpropanoyl)amino]-N,N-dimethylbenzamide (PubChem CID 505205) has the molecular formula C23H21ClN4O3 and a molecular weight of 436.90 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)methyl-(3-oxo-3-pyrimidin-2-ylpropanoyl)amino]-N,N-dimethylbenzamide.
| Compound Name | 3-[(4-chlorophenyl)methyl-(3-oxo-3-pyrimidin-2-ylpropanoyl)amino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 505205 |
| Molecular Formula | C23H21ClN4O3 |
| Molecular Weight | 436.90 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 3-[(4-chlorophenyl)methyl-(3-oxo-3-pyrimidin-2-ylpropanoyl)amino]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cccc(N(Cc2ccc(Cl)cc2)C(=O)CC(=O)c2ncccn2)c1 |
| InChI | InChI=1S/C23H21ClN4O3/c1-27(2)23(31)17-5-3-6-19(13-17)28(15-16-7-9-18(24)10-8-16)21(30)14-20(29)22-25-11-4-12-26-22/h3-13H,14-15H2,1-2H3 |
| InChIKey | NLJXSRVXGGYVGX-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 83.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.90 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|