C25H24Cl2N4O3 — CID 505274
4-[(3,4-dichlorophenyl)methyl-(3-oxo-3-pyrimidin-2-ylpropanoyl)amino]-N,N-diethylbenzamide (PubChem CID 505274) has the molecular formula C25H24Cl2N4O3 and a molecular weight of 499.40 g/mol. Its IUPAC name is 4-[(3,4-dichlorophenyl)methyl-(3-oxo-3-pyrimidin-2-ylpropanoyl)amino]-N,N-diethylbenzamide.
| Compound Name | 4-[(3,4-dichlorophenyl)methyl-(3-oxo-3-pyrimidin-2-ylpropanoyl)amino]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 505274 |
| Molecular Formula | C25H24Cl2N4O3 |
| Molecular Weight | 499.40 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | 4-[(3,4-dichlorophenyl)methyl-(3-oxo-3-pyrimidin-2-ylpropanoyl)amino]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(N(Cc2ccc(Cl)c(Cl)c2)C(=O)CC(=O)c2ncccn2)cc1 |
| InChI | InChI=1S/C25H24Cl2N4O3/c1-3-30(4-2)25(34)18-7-9-19(10-8-18)31(16-17-6-11-20(26)21(27)14-17)23(33)15-22(32)24-28-12-5-13-29-24/h5-14H,3-4,15-16H2,1-2H3 |
| InChIKey | SOJKXGBXANJDLA-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 83.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.40 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|