C22H17Cl2N3O4 — CID 505341
3-[[(3,4-dichlorophenyl)methyl-(3-oxo-3-pyrimidin-2-ylpropanoyl)amino]methyl]benzoic acid (PubChem CID 505341) has the molecular formula C22H17Cl2N3O4 and a molecular weight of 458.30 g/mol. Its IUPAC name is 3-[[(3,4-dichlorophenyl)methyl-(3-oxo-3-pyrimidin-2-ylpropanoyl)amino]methyl]benzoic acid.
| Compound Name | 3-[[(3,4-dichlorophenyl)methyl-(3-oxo-3-pyrimidin-2-ylpropanoyl)amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 505341 |
| Molecular Formula | C22H17Cl2N3O4 |
| Molecular Weight | 458.30 g/mol |
| Exact Mass | 457.06 |
| IUPAC Name | 3-[[(3,4-dichlorophenyl)methyl-(3-oxo-3-pyrimidin-2-ylpropanoyl)amino]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CN(Cc2ccc(Cl)c(Cl)c2)C(=O)CC(=O)c2ncccn2)c1 |
| InChI | InChI=1S/C22H17Cl2N3O4/c23-17-6-5-15(10-18(17)24)13-27(12-14-3-1-4-16(9-14)22(30)31)20(29)11-19(28)21-25-7-2-8-26-21/h1-10H,11-13H2,(H,30,31) |
| InChIKey | KZCMDSPJSWQGBA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 100.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.30 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|