C24H22Cl2N4O4 — CID 505215
3-[(3,5-dichloro-4-methoxyphenyl)methyl-(3-oxo-3-pyrimidin-2-ylpropanoyl)amino]-N,N-dimethylbenzamide (PubChem CID 505215) has the molecular formula C24H22Cl2N4O4 and a molecular weight of 501.37 g/mol. Its IUPAC name is 3-[(3,5-dichloro-4-methoxyphenyl)methyl-(3-oxo-3-pyrimidin-2-ylpropanoyl)amino]-N,N-dimethylbenzamide.
| Compound Name | 3-[(3,5-dichloro-4-methoxyphenyl)methyl-(3-oxo-3-pyrimidin-2-ylpropanoyl)amino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 505215 |
| Molecular Formula | C24H22Cl2N4O4 |
| Molecular Weight | 501.37 g/mol |
| Exact Mass | 500.10 |
| IUPAC Name | 3-[(3,5-dichloro-4-methoxyphenyl)methyl-(3-oxo-3-pyrimidin-2-ylpropanoyl)amino]-N,N-dimethylbenzamide |
| SMILES | COc1c(Cl)cc(CN(C(=O)CC(=O)c2ncccn2)c2cccc(C(=O)N(C)C)c2)cc1Cl |
| InChI | InChI=1S/C24H22Cl2N4O4/c1-29(2)24(33)16-6-4-7-17(12-16)30(14-15-10-18(25)22(34-3)19(26)11-15)21(32)13-20(31)23-27-8-5-9-28-23/h4-12H,13-14H2,1-3H3 |
| InChIKey | OVRYTTRBDGIGHF-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 92.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.37 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|