C24H21Cl2N3O4 — CID 505342
3-[(3,4-dichlorophenyl)methyl-[3-(3-hydroxy-2-pyridinyl)-3-oxopropanoyl]amino]-N,N-dimethylbenzamide (PubChem CID 505342) has the molecular formula C24H21Cl2N3O4 and a molecular weight of 486.36 g/mol. Its IUPAC name is 3-[(3,4-dichlorophenyl)methyl-[3-(3-hydroxy-2-pyridinyl)-3-oxopropanoyl]amino]-N,N-dimethylbenzamide.
| Compound Name | 3-[(3,4-dichlorophenyl)methyl-[3-(3-hydroxy-2-pyridinyl)-3-oxopropanoyl]amino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 505342 |
| Molecular Formula | C24H21Cl2N3O4 |
| Molecular Weight | 486.36 g/mol |
| Exact Mass | 485.09 |
| IUPAC Name | 3-[(3,4-dichlorophenyl)methyl-[3-(3-hydroxy-2-pyridinyl)-3-oxopropanoyl]amino]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cccc(N(Cc2ccc(Cl)c(Cl)c2)C(=O)CC(=O)c2ncccc2O)c1 |
| InChI | InChI=1S/C24H21Cl2N3O4/c1-28(2)24(33)16-5-3-6-17(12-16)29(14-15-8-9-18(25)19(26)11-15)22(32)13-21(31)23-20(30)7-4-10-27-23/h3-12,30H,13-14H2,1-2H3 |
| InChIKey | UOAOJDFCZLJROX-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 90.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.36 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|