C22H22N4O4S — CID 505068
N-benzyl-N-[3-(dimethylsulfamoyl)phenyl]-3-oxo-3-pyrimidin-2-ylpropanamide (PubChem CID 505068) has the molecular formula C22H22N4O4S and a molecular weight of 438.51 g/mol. Its IUPAC name is N-benzyl-N-[3-(dimethylsulfamoyl)phenyl]-3-oxo-3-pyrimidin-2-ylpropanamide.
| Compound Name | N-benzyl-N-[3-(dimethylsulfamoyl)phenyl]-3-oxo-3-pyrimidin-2-ylpropanamide |
|---|---|
| PubChem CID | 505068 |
| Molecular Formula | C22H22N4O4S |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | N-benzyl-N-[3-(dimethylsulfamoyl)phenyl]-3-oxo-3-pyrimidin-2-ylpropanamide |
| SMILES | CN(C)S(=O)(=O)c1cccc(N(Cc2ccccc2)C(=O)CC(=O)c2ncccn2)c1 |
| InChI | InChI=1S/C22H22N4O4S/c1-25(2)31(29,30)19-11-6-10-18(14-19)26(16-17-8-4-3-5-9-17)21(28)15-20(27)22-23-12-7-13-24-22/h3-14H,15-16H2,1-2H3 |
| InChIKey | YWEWCPUPKVNPLO-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 100.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|