C21H25N3O5S — CID 89237490
benzyl-[3-[methyl-[3-(prop-2-enoylamino)propyl]sulfamoyl]phenyl]carbamic acid (PubChem CID 89237490) has the molecular formula C21H25N3O5S and a molecular weight of 431.51 g/mol. Its IUPAC name is benzyl-[3-[methyl-[3-(prop-2-enoylamino)propyl]sulfamoyl]phenyl]carbamic acid.
| Compound Name | benzyl-[3-[methyl-[3-(prop-2-enoylamino)propyl]sulfamoyl]phenyl]carbamic acid |
|---|---|
| PubChem CID | 89237490 |
| Molecular Formula | C21H25N3O5S |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | benzyl-[3-[methyl-[3-(prop-2-enoylamino)propyl]sulfamoyl]phenyl]carbamic acid |
| SMILES | C=CC(=O)NCCCN(C)S(=O)(=O)c1cccc(N(Cc2ccccc2)C(=O)O)c1 |
| InChI | InChI=1S/C21H25N3O5S/c1-3-20(25)22-13-8-14-23(2)30(28,29)19-12-7-11-18(15-19)24(21(26)27)16-17-9-5-4-6-10-17/h3-7,9-12,15H,1,8,13-14,16H2,2H3,(H,22,25)(H,26,27) |
| InChIKey | BKBBWVDQZODURK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|