C19H25N3O4S — CID 89237716
N-[3-[[1-(cyclopropanecarbonyl)-2,3-dihydroindol-5-yl]sulfonyl-methylamino]propyl]prop-2-enamide (PubChem CID 89237716) has the molecular formula C19H25N3O4S and a molecular weight of 391.49 g/mol. Its IUPAC name is N-[3-[[1-(cyclopropanecarbonyl)-2,3-dihydroindol-5-yl]sulfonyl-methylamino]propyl]prop-2-enamide.
| Compound Name | N-[3-[[1-(cyclopropanecarbonyl)-2,3-dihydroindol-5-yl]sulfonyl-methylamino]propyl]prop-2-enamide |
|---|---|
| PubChem CID | 89237716 |
| Molecular Formula | C19H25N3O4S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | N-[3-[[1-(cyclopropanecarbonyl)-2,3-dihydroindol-5-yl]sulfonyl-methylamino]propyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCCN(C)S(=O)(=O)c1ccc2c(c1)CCN2C(=O)C1CC1 |
| InChI | InChI=1S/C19H25N3O4S/c1-3-18(23)20-10-4-11-21(2)27(25,26)16-7-8-17-15(13-16)9-12-22(17)19(24)14-5-6-14/h3,7-8,13-14H,1,4-6,9-12H2,2H3,(H,20,23) |
| InChIKey | AYGXAPXWFBZQFH-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|